| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:10:59 UTC |
|---|
| Update Date | 2025-03-21 18:31:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088385 |
|---|
| Frequency | 32.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H28O10 |
|---|
| Molecular Mass | 416.1682 |
|---|
| SMILES | O=C(CCCC(O)Cc1ccccc1)OCOC1OC(C(O)O)C(O)C(O)C1O |
|---|
| InChI Key | PPAKHWGAOJGXNA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acid esters |
|---|
| Direct Parent | fatty acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzene and substituted derivativescarbonyl compoundscarbonyl hydratescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupcarbonyl hydratearomatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativeoxacyclefatty acid estersaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundacetalcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidoxaneorganoheterocyclic compoundorganooxygen compound |
|---|