| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:11:00 UTC |
|---|
| Update Date | 2025-03-21 18:31:57 UTC |
|---|
| HMDB ID | HMDB0030587 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088416 |
|---|
| Name | Spinacetin |
|---|
| Frequency | 32.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O8 |
|---|
| Molecular Mass | 346.0689 |
|---|
| SMILES | COc1cc(-c2oc3cc(O)c(OC)c(O)c3c(=O)c2O)ccc1O |
|---|
| InChI Key | XWIDINOKCRFVHQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-o-methylated flavonoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids6-o-methylated flavonoids7-hydroxyflavonoidsalkyl aryl ethersanisoleschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | 3-hydroxyflavonephenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran6-methoxyflavonoid-skeleton1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidmethoxybenzene3p-methoxyflavonoid-skeletonoxacyclevinylogous acidorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|