| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:02 UTC |
|---|
| Update Date | 2025-03-21 18:31:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088475 |
|---|
| Frequency | 32.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14N2O2 |
|---|
| Molecular Mass | 254.1055 |
|---|
| SMILES | O=C(c1cccnc1)N1Cc2ccccc2C(O)C1 |
|---|
| InChI Key | VKPBDBYOFWYNGN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | tetrahydroisoquinolines |
|---|
| Subclass | tetrahydroisoquinolines |
|---|
| Direct Parent | tetrahydroisoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyridinecarboxylic acids and derivativessecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | pyridine carboxylic acid or derivativesalcoholazacycleheteroaromatic compoundhydroxypyridinecarboxamide groupcarboxylic acid derivativeorganic oxidepyridineorganic oxygen compoundaromatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundtetrahydroisoquinolinesecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
