| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 00:11:06 UTC |
|---|
| Update Date | 2025-03-21 18:32:00 UTC |
|---|
| HMDB ID | HMDB0001270 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088654 |
|---|
| Name | Glyceric acid 1,3-biphosphate |
|---|
| Frequency | 32.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H8O10P2 |
|---|
| Molecular Mass | 265.9593 |
|---|
| SMILES | O=C(OP(=O)(O)O)C(O)COP(=O)(O)O |
|---|
| InChI Key | LJQLQCAXBUHEAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | acyl monophosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholssugar acids and derivatives |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupacyl monophosphatemonosaccharidecarboxylic acid derivativesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundglyceric_acidmonoalkyl phosphatesecondary alcoholhydrocarbon derivativealkyl phosphateorganooxygen compound |
|---|
