| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:07 UTC |
|---|
| Update Date | 2025-03-21 18:32:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088681 |
|---|
| Frequency | 31.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H15NO4 |
|---|
| Molecular Mass | 297.1001 |
|---|
| SMILES | NC(CC(=O)c1cccc(C(=O)c2ccccc2)c1)C(=O)O |
|---|
| InChI Key | JVUMWOKQWXQCKB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl-phenylketonesalpha amino acidsaryl alkyl ketonesaryl-phenylketonesbenzoyl derivativesbutyrophenonescarboxylic acidsdiphenylmethanesgamma-keto acids and derivativeshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidaryl alkyl ketonebenzoylalpha-amino acid or derivativescarboxylic acid derivativebenzophenoneketoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundaryl-phenylketonephenylketonegamma-keto acidbutyrophenonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundketo acidhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
