| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:12 UTC |
|---|
| Update Date | 2025-03-21 18:32:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088860 |
|---|
| Frequency | 31.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10NO6P |
|---|
| Molecular Mass | 211.0246 |
|---|
| SMILES | O=C(O)C1CC(O)CN1P(=O)(O)O |
|---|
| InChI Key | LBVRBYKMLGPWPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | proline and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compoundspyrrolidine carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidorganic oxidepyrrolidine carboxylic acidaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganic phosphoric acid amideorganoheterocyclic compoundproline or derivativesalcoholazacyclemonocarboxylic acid or derivativespyrrolidine carboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|