| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:14 UTC |
|---|
| Update Date | 2025-03-21 18:32:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00088960 |
|---|
| Frequency | 31.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O3 |
|---|
| Molecular Mass | 228.0786 |
|---|
| SMILES | O=C(O)Cc1cccc(Oc2ccccc2)c1 |
|---|
| InChI Key | LEMRHTTWKDVQEI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdiarylethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol ethercarbonyl groupethercarboxylic acidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativephenoxy compounddiphenyletherorganooxygen compound |
|---|
