| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:18 UTC |
|---|
| Update Date | 2025-03-21 18:32:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00089093 |
|---|
| Frequency | 31.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H12O6S |
|---|
| Molecular Mass | 224.0355 |
|---|
| SMILES | CSC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | CKAAHCBAWAIEFK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | s-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesmonothioacetalsorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholssulfenyl compounds |
|---|
| Substituents | carbonyl groups-glucuronidecarboxylic acidmonosaccharideorganosulfur compoundcarboxylic acid derivativepyran carboxylic acidmonothioacetalbeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compound1-s-glucuronideoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativessulfenyl compoundhydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
|---|
