| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:23 UTC |
|---|
| Update Date | 2025-03-21 18:32:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00089274 |
|---|
| Frequency | 31.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16F2N2O2 |
|---|
| Molecular Mass | 270.118 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OC(F)F)cc2)CC1 |
|---|
| InChI Key | UTCNZDYAGYWYLN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl fluoridesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganofluoridesorganopnictogen compoundsphenol ethersphenoxy compoundstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundalkyl halidedialkylarylaminetertiary amineacetamideazacyclealkyl fluorideorganofluorideaniline or substituted anilinescarboxamide groupphenylpiperazineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
