| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:26 UTC |
|---|
| Update Date | 2025-03-21 18:32:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00089402 |
|---|
| Frequency | 31.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O5S |
|---|
| Molecular Mass | 228.0092 |
|---|
| SMILES | O=C(O)C=Cc1ccc(O)c(S(=O)O)c1 |
|---|
| InChI Key | SSEVBZCTRFWTPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganosulfur compoundssulfinic acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidsulfinic acid derivative1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativesulfinic acidhydroxycinnamic acidaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|