| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:30 UTC |
|---|
| Update Date | 2025-03-21 18:32:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00089555 |
|---|
| Frequency | 31.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H9NO5S |
|---|
| Molecular Mass | 231.0201 |
|---|
| SMILES | NS(=O)(=O)c1cc(CC(=O)O)ccc1O |
|---|
| InChI Key | RCWYNNKBKVORON-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaminosulfonyl compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic nitrogen compoundsorganic oxidesorganosulfonamides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupbenzenesulfonamidecarboxylic acidaminosulfonyl compound1-hydroxy-2-unsubstituted benzenoidorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amidearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundbenzenesulfonyl group |
|---|
