| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:31 UTC |
|---|
| Update Date | 2025-03-21 18:32:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00089604 |
|---|
| Frequency | 31.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O8 |
|---|
| Molecular Mass | 284.0532 |
|---|
| SMILES | O=C(O)CC(O)(CC(=O)Oc1ccc(O)cc1)C(=O)O |
|---|
| InChI Key | TXKGETDCRJWWKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenol esters |
|---|
| Subclass | phenol esters |
|---|
| Direct Parent | phenol esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsfatty acid estershydrocarbon derivativesorganic oxidesphenoxy compoundstertiary alcoholstricarboxylic acids and derivatives |
|---|
| Substituents | alcoholfatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidalpha-hydroxy acid1-hydroxy-2-unsubstituted benzenoidtricarboxylic acid or derivativeshydroxy acidcarboxylic acid derivativearomatic homomonocyclic compoundfatty acid estertertiary alcoholorganic oxideorganic oxygen compoundcarboxylic acid esterphenol esterphenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
