| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:33 UTC |
|---|
| Update Date | 2025-03-21 18:32:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00089674 |
|---|
| Frequency | 31.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11NO3S |
|---|
| Molecular Mass | 237.046 |
|---|
| SMILES | COc1ccc2cc(S(N)(=O)=O)ccc2c1 |
|---|
| InChI Key | FMZMBZYDYWZGKA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 2-naphthalene sulfonamides |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 2-naphthalene sulfonic acids and derivativesalkyl aryl ethersaminosulfonyl compoundsanisoleshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganosulfonamides |
|---|
| Substituents | phenol etherorganosulfonic acid or derivativesetheraminosulfonyl compoundaromatic homopolycyclic compoundalkyl aryl etherorganosulfur compound2-naphthalene sulfonamideorganosulfonic acid amide2-naphthalene sulfonic acid or derivativesorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesanisolehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|