| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:37 UTC |
|---|
| Update Date | 2025-03-21 18:32:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00089854 |
|---|
| Frequency | 31.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N6O5P |
|---|
| Molecular Mass | 328.0685 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(N)(=O)OC2C1O |
|---|
| InChI Key | HIJOCKIMPYSNQV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoramidesorganopnictogen compoundsoxacyclic compoundsphosphoric diester monoamidesprimary aminespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofurans |
|---|
| Substituents | monosaccharidepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundphosphoric diester monoamideimidolactamorganic phosphoric acid amideazolen-substituted imidazolealcoholazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
