| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:43 UTC |
|---|
| Update Date | 2025-03-21 18:32:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090071 |
|---|
| Frequency | 31.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18O7 |
|---|
| Molecular Mass | 322.1053 |
|---|
| SMILES | OCC1OC(Oc2ccc3cc(O)ccc3c2)C(O)C(O)C1O |
|---|
| InChI Key | DKHZRRLOEODUAV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol ether1-hydroxy-2-unsubstituted benzenoidmonosaccharideoxacyclesaccharideorganic oxygen compoundacetalaromatic heteropolycyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcohol2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|