| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:46 UTC |
|---|
| Update Date | 2025-03-21 18:32:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090216 |
|---|
| Frequency | 31.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N3O6 |
|---|
| Molecular Mass | 273.0961 |
|---|
| SMILES | N=C(NC(CC(=O)O)C(=O)O)N1CCCC1C(=O)O |
|---|
| InChI Key | OPSAPMPAOLINEJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboximidamidescarboxylic acidsguanidineshydrocarbon derivativesiminesorganic oxidesorganopnictogen compoundsproline and derivativespyrrolidine carboxylic acidstricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidguanidineiminetricarboxylic acid or derivativesorganic oxidepyrrolidine carboxylic acidaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compoundproline or derivativesazacyclecarboximidamidepyrrolidine carboxylic acid or derivativesorganic oxygen compoundaspartic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
