| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:48 UTC |
|---|
| Update Date | 2025-03-21 18:32:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090270 |
|---|
| Frequency | 31.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14N2O5 |
|---|
| Molecular Mass | 242.0903 |
|---|
| SMILES | Cc1cn(C2OC(CO)C(O)C2O)ncc1=O |
|---|
| InChI Key | WQURGULTRALAFS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyridazines and derivatives |
|---|
| Direct Parent | pyridazines and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic ketonesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofuransvinylogous amides |
|---|
| Substituents | alcoholvinylogous amidearomatic heteromonocyclic compoundazacycletetrahydrofuranheteroaromatic compoundmonosaccharidecyclic ketoneoxacyclesaccharideorganic oxideorganic oxygen compoundpyridazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|