| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:50 UTC |
|---|
| Update Date | 2025-03-21 18:32:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090366 |
|---|
| Frequency | 41.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H14N5O7P |
|---|
| Molecular Mass | 359.0631 |
|---|
| SMILES | CNc1nc2c(ncn2C2OC3COP(=O)(O)OC3C2O)c(=O)[nH]1 |
|---|
| InChI Key | SFDBSQYPCKCZGC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleotides |
|---|
| Subclass | cyclic purine nucleotides |
|---|
| Direct Parent | 3',5'-cyclic purine nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshypoxanthinesimidazoleslactamsmonosaccharidesn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundspentose phosphatespurines and purine derivativespyrimidonessecondary alcoholssecondary alkylarylaminestetrahydrofuransvinylogous amides |
|---|
| Substituents | lactampentose phosphatemonosaccharidepyrimidoneimidazopyrimidinepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolealcoholvinylogous amideazacycletetrahydrofuranheteroaromatic compound3',5'-cyclic purine ribonucleotidesecondary aminesecondary aliphatic/aromatic amineoxacycleorganic oxygen compoundsecondary alcoholhypoxanthinehydrocarbon derivativepurineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundamine |
|---|
