| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:51 UTC |
|---|
| Update Date | 2025-03-21 18:32:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090421 |
|---|
| Frequency | 31.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O8 |
|---|
| Molecular Mass | 336.0845 |
|---|
| SMILES | Oc1cc(O)c2c(c1)OC(c1cc(O)c(O)c(O)c1)C(O)C(O)C2 |
|---|
| InChI Key | ZWZGJTMBZGUCDD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzoxepines |
|---|
| Subclass | benzoxepines |
|---|
| Direct Parent | benzoxepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compoundspyrogallols and derivativessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyetherpyrogallol derivativebenzenetriolbenzoxepine1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound1,2-diol |
|---|