| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:11:52 UTC |
|---|
| Update Date | 2025-03-21 18:32:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090454 |
|---|
| Frequency | 31.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H20N2O |
|---|
| Molecular Mass | 232.1576 |
|---|
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2C |
|---|
| InChI Key | GMYGWDMDFAGPPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | n-alkylindoles |
|---|
| Direct Parent | n-alkylindoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkaloids and derivativesalkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesn-methylpyrrolesorganopnictogen compoundssubstituted pyrrolestrialkylamines |
|---|
| Substituents | phenol ethern-methylpyrroleethern-alkylindoleindolesubstituted pyrrolealkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary amineazacycleheteroaromatic compoundtertiary aliphatic aminealkaloid or derivativesorganic oxygen compoundanisolepyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|