| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:00 UTC |
|---|
| Update Date | 2025-03-21 18:32:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090767 |
|---|
| Frequency | 31.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H10NO7P |
|---|
| Molecular Mass | 215.0195 |
|---|
| SMILES | NC(C(=O)OP(=O)(O)O)C(O)CO |
|---|
| InChI Key | QQOGULMUWHGTMV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacyl monophosphatesbeta hydroxy acids and derivativescarbonyl compoundshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminesprimary alcoholssecondary alcohols |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupphosphoethanolaminebeta-hydroxy acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcohol1,2-diolalcoholacyl monophosphatehydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compoundacyl phosphate |
|---|
