| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:01 UTC |
|---|
| Update Date | 2025-03-21 18:32:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090822 |
|---|
| Frequency | 31.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8N4O5 |
|---|
| Molecular Mass | 252.0495 |
|---|
| SMILES | O=C(O)C(O)Cn1ccnc2c(=O)[nH]c(=O)nc1-2 |
|---|
| InChI Key | DSOCBKAHAAAJKN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pteridines and derivatives |
|---|
| Direct Parent | pteridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidalpha-hydroxy acidpyrimidonepteridinecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholcarbonic acid derivativeazacycleheteroaromatic compoundhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundpyrazinesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
