| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:02 UTC |
|---|
| Update Date | 2025-03-21 18:32:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090842 |
|---|
| Frequency | 30.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H16O11P2 |
|---|
| Molecular Mass | 338.0168 |
|---|
| SMILES | O=P(O)(O)CC1OC(COP(=O)(O)O)C(O)C(O)C1O |
|---|
| InChI Key | AWCFOUNASLSVNE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | dialkyl ethershydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic oxidesorganic phosphonic acids and derivativesorganophosphorus compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholetherdialkyl etheroxacycleorganic oxidephosphoric acid estermonoalkyl phosphatealiphatic heteromonocyclic compoundsecondary alcoholhexose phosphateorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeoxaneorganic phosphoric acid derivativeorganophosphonic acid derivativealkyl phosphateorganoheterocyclic compound |
|---|