| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:03 UTC |
|---|
| Update Date | 2025-03-21 18:32:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090909 |
|---|
| Frequency | 30.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O12S2 |
|---|
| Molecular Mass | 337.9614 |
|---|
| SMILES | O=C1OC(COS(=O)(=O)O)C(O)C(O)C1OS(=O)(=O)O |
|---|
| InChI Key | YKEQUWOKESWFMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | gluconolactones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalkyl sulfatescarbonyl compoundscarboxylic acid estersdelta valerolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupdelta valerolactonecarboxylic acid derivativelactoneorganic oxidegluconolactonealkyl sulfatealiphatic heteromonocyclic compoundoxanedelta_valerolactoneorganoheterocyclic compound1,2-diolalcoholorganic sulfuric acid or derivativesoxacyclemonocarboxylic acid or derivativescarboxylic acid estersecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid ester |
|---|