| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:05 UTC |
|---|
| Update Date | 2025-03-21 18:32:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00090967 |
|---|
| Frequency | 30.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H18NO9P |
|---|
| Molecular Mass | 327.0719 |
|---|
| SMILES | O=C(O)C1CCCN1C1OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | DXAXTKKXIJLGIV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidshemiaminalshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesn-alkylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsproline and derivativespyrrolidine carboxylic acidssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acidpentose phosphatepentose-5-phosphatealpha-amino acid or derivativescarboxylic acid derivativehemiaminalorganic oxidepyrrolidine carboxylic acidaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundpyrrolidineorganoheterocyclic compound1,2-diolproline or derivativesalcoholazacyclen-alkylpyrrolidinetetrahydrofuranoxacyclemonocarboxylic acid or derivativespyrrolidine carboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|