| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:06 UTC |
|---|
| Update Date | 2025-03-21 18:32:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00091039 |
|---|
| Frequency | 30.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11O9P |
|---|
| Molecular Mass | 270.0141 |
|---|
| SMILES | O=C1OC(C(O)CO)C(COP(=O)(O)O)=C1O |
|---|
| InChI Key | YKCKSBKFHHSESZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsbutenolidescarbonyl compoundsdihydrofuransenoate estershydrocarbon derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsprimary alcoholssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acid derivativelactonealpha,beta-unsaturated carboxylic ester2-furanoneorganic oxidealiphatic heteromonocyclic compoundprimary alcoholorganoheterocyclic compound1,2-dioldihydrofuranenoate esteralcoholoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|