| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:12 UTC |
|---|
| Update Date | 2025-03-21 18:32:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00091269 |
|---|
| Frequency | 30.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H19NO3 |
|---|
| Molecular Mass | 225.1365 |
|---|
| SMILES | C=CC1CN2CCC1CC(O)C2C(=O)OC |
|---|
| InChI Key | DBAMSNYQVGPETF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid esters |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsazepanesbeta hydroxy acids and derivativescarbonyl compoundshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspiperidinessecondary alcoholstrialkylamines |
|---|
| Substituents | carbonyl groupaliphatic heteropolycyclic compoundbeta-hydroxy acidorganic oxidemethyl esterorganonitrogen compoundalpha-amino acidorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundalcoholalpha-amino acid esterazacycletertiary aliphatic aminehydroxy acidmonocarboxylic acid or derivativesazepaneorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|