| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:12 UTC |
|---|
| Update Date | 2025-03-21 18:32:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00091280 |
|---|
| Frequency | 30.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O8 |
|---|
| Molecular Mass | 318.0376 |
|---|
| SMILES | O=c1oc(-c2cc(O)c(O)c(O)c2)c(O)c2cc(O)cc(O)c12 |
|---|
| InChI Key | QDRJEDQBIPYHTA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isocoumarins and derivatives |
|---|
| Subclass | isocoumarins and derivatives |
|---|
| Direct Parent | isocoumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids2-benzopyransbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativespyrogallols and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietybenzopyranpyrogallol derivativebenzenetriolheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidisocoumarinlactoneoxacyclevinylogous acidorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|