| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:20 UTC |
|---|
| Update Date | 2025-03-21 18:32:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00091588 |
|---|
| Frequency | 30.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H7NO6S |
|---|
| Molecular Mass | 244.9994 |
|---|
| SMILES | O=C1Nc2ccc(S(=O)(=O)O)cc2OC1O |
|---|
| InChI Key | UBYSBYQSTNSCBQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzoxazines |
|---|
| Subclass | benzoxazinones |
|---|
| Direct Parent | benzoxazinones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesazacyclic compoundsbenzenoidsbenzomorpholinescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativeslactamsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acidsoxacyclic compoundssecondary carboxylic acid amidessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl grouplactamorganosulfonic acidorganosulfur compoundcarboxylic acid derivativebenzomorpholineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetal1-sulfo,2-unsubstituted aromatic compoundazacyclecarboxamide groupoxazinaneoxacyclesecondary carboxylic acid amidemorpholinesulfonylbenzoxazinoneorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|