| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:23 UTC |
|---|
| Update Date | 2025-03-21 18:32:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00091721 |
|---|
| Frequency | 30.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H17NO10 |
|---|
| Molecular Mass | 371.0852 |
|---|
| SMILES | O=C(O)C1Cc2c(O)cc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2N1 |
|---|
| InChI Key | PDVIJDNTGFAEEX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsalpha amino acidsamino acidsazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesindolecarboxylic acidsindolesindolinesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol etherspyran carboxylic acidssecondary alcoholssecondary alkylarylamines |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidamino acid or derivativesamino acidindoleo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidealpha-amino acid or derivativescarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxanedihydroindoleorganoheterocyclic compoundindolecarboxylic acid derivativealcoholpyran carboxylic acid or derivativesazacycleindole or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidsecondary aminesecondary aliphatic/aromatic amineoxacyclepyranindolecarboxylic acidsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundamine |
|---|