| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:24 UTC |
|---|
| Update Date | 2025-03-21 18:32:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00091742 |
|---|
| Frequency | 30.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H7Cl9 |
|---|
| Molecular Mass | 453.7744 |
|---|
| SMILES | ClCC1C(Cl)C(Cl)C2C1C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
|---|
| InChI Key | QTFIIVXEUJFIGJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | iridoids and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschloroalkeneshydrocarbon derivativesorganochloridesvinyl chlorides |
|---|
| Substituents | alkyl chloridechloroalkeneorganochlorideorganohalogen compoundaliphatic homopolycyclic compoundvinyl halidehaloalkenealkyl halidehydrocarbon derivativevinyl chloride11-noriridane monoterpenoid |
|---|