| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:26 UTC |
|---|
| Update Date | 2025-03-21 18:32:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00091835 |
|---|
| Frequency | 30.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H24N2O3 |
|---|
| Molecular Mass | 232.1787 |
|---|
| SMILES | CN(C)CCCNC(=O)C(O)C(C)(C)CO |
|---|
| InChI Key | HQOMSERGENCDMD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty amides |
|---|
| Direct Parent | n-acyl amines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amino acids and derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupamino acid or derivativestertiary aliphatic aminemonosaccharidecarboxamide groupcarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amidesaccharideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|