| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:32 UTC |
|---|
| Update Date | 2025-03-21 18:32:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092054 |
|---|
| Frequency | 30.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O6 |
|---|
| Molecular Mass | 186.0164 |
|---|
| SMILES | O=C(O)c1ccc(C(O)C(=O)O)o1 |
|---|
| InChI Key | UAFTYLJFMASQBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaromatic alcoholscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholcarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundalpha-hydroxy acidheteroaromatic compoundhydroxy acidcarboxylic acid derivativefuroic acidoxacycleorganic oxideorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|