| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:36 UTC |
|---|
| Update Date | 2025-03-21 18:32:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092220 |
|---|
| Frequency | 30.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10NO5S- |
|---|
| Molecular Mass | 232.0285 |
|---|
| SMILES | CC(=O)Nc1ccccc1O[SH](=O)([O-])O |
|---|
| InChI Key | UNJTZTJCGSEUDX-UHFFFAOYSA-M |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic anionsorganic oxidesorganic oxoanionic compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupn-acetylarylamineacetaniliden-arylamidecarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic anionorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganic bisulfiteacetamideorganooxygen compound |
|---|
