| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:12:36 UTC |
|---|
| Update Date | 2025-03-21 18:32:42 UTC |
|---|
| HMDB ID | HMDB0129961 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092226 |
|---|
| Name | 2-(4-methoxyphenyl)-1-(2,3,4,6-tetrahydroxyphenyl)propan-1-one |
|---|
| Frequency | 30.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O6 |
|---|
| Molecular Mass | 304.0947 |
|---|
| SMILES | COc1ccc(C(C)C(=O)c2c(O)cc(O)c(O)c2O)cc1 |
|---|
| InChI Key | LUAUGUQWDWMXBN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | alpha-methyldeoxybenzoin flavonoids |
|---|
| Subclass | alpha-methyldeoxybenzoin flavonoids |
|---|
| Direct Parent | alpha-methyldeoxybenzoin flavonoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl aryl ethersalkyl-phenylketonesanisolesaryl alkyl ketonesbenzoyl derivativeshydrocarbon derivativesmethoxybenzenesorganic oxidesphenoxy compoundsphenylpropanesstilbenesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketonephenylpropanephloroglucinol derivativeorganic oxideacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenephenylketonealpha-methyldeoxybenzoin flavonoidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|