| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 00:12:37 UTC |
|---|
| Update Date | 2025-03-21 18:32:42 UTC |
|---|
| HMDB ID | HMDB0014772 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092252 |
|---|
| Name | Sulfacetamide |
|---|
| Frequency | 30.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N2O3S |
|---|
| Molecular Mass | 214.0412 |
|---|
| SMILES | CC(=O)NS(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | SKIVFJLNDNKQPD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaminosulfonyl compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativesprimary amines |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupbenzenesulfonamideaminosulfonyl compoundamino acid or derivativesorganosulfur compoundcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineacetamideorganooxygen compoundbenzenesulfonyl group |
|---|