| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:40 UTC |
|---|
| Update Date | 2025-03-21 18:32:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092408 |
|---|
| Frequency | 30.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8Cl2O2 |
|---|
| Molecular Mass | 229.9901 |
|---|
| SMILES | O=C1CCC(c2ccc(Cl)c(Cl)c2)O1 |
|---|
| InChI Key | HSAZYDYRKKZYSQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesoxacyclic compoundstetrahydrofurans |
|---|
| Substituents | aryl chloridecarbonyl grouparomatic heteromonocyclic compoundtetrahydrofuranorganochloridecarboxylic acid derivativeorganohalogen compoundgamma butyrolactonearyl halidelactoneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivative1,2-dichlorobenzeneorganoheterocyclic compoundorganooxygen compound |
|---|
