| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:41 UTC |
|---|
| Update Date | 2025-03-21 18:32:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092449 |
|---|
| Frequency | 30.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O7 |
|---|
| Molecular Mass | 252.027 |
|---|
| SMILES | O=c1c(O)coc(-c2cc(O)c(O)c(O)c2)c1O |
|---|
| InChI Key | YSCPPMUJXRZUHA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescyclic ketonesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | monocyclic benzene moietypyrogallol derivativearomatic heteromonocyclic compoundheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcyclic ketone1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundpyranpyranonehydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|