| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:47 UTC |
|---|
| Update Date | 2025-03-21 18:32:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092692 |
|---|
| Frequency | 30.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H23FN2O2 |
|---|
| Molecular Mass | 342.1744 |
|---|
| SMILES | CN(C)CCCC1(c2ccc(F)cc2)OCc2cc(C(N)=O)ccc21 |
|---|
| InChI Key | LYYWQJNKWCANAC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl fluoridescarboxylic acids and derivativesdialkyl ethersfluorobenzeneshydrocarbon derivativesisocoumaransorganic oxidesorganofluoridesorganopnictogen compoundsoxacyclic compoundsprimary carboxylic acid amidestrialkylamines |
|---|
| Substituents | aryl fluorideprimary carboxylic acid amideetheramino acid or derivativescarboxylic acid derivativeorganohalogen compounddialkyl etherfluorobenzeneorganic oxidephenylbutylamineisocoumaranaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundorganofluoridetertiary aliphatic aminecarboxamide grouparyl halideoxacycleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
|---|
