| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:49 UTC |
|---|
| Update Date | 2025-03-21 18:32:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092758 |
|---|
| Frequency | 30.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8O6 |
|---|
| Molecular Mass | 188.0321 |
|---|
| SMILES | O=C(O)C1=CC(O)C(O)C(O)C1=O |
|---|
| InChI Key | CFFRHMQBPSUDNC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | shikimic acids and derivatves |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carboxylic acidscyclohexenoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | cyclohexenonecarbonyl groupcarboxylic acidcyclic ketonecarboxylic acid derivativeshikimic acid or derivativesketoneorganic oxidemonocarboxylic acid or derivativessecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivative |
|---|
