| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-21 00:12:49 UTC |
|---|
| Update Date | 2025-03-21 18:32:48 UTC |
|---|
| HMDB ID | HMDB0126114 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092779 |
|---|
| Name | 3,4,5-trihydroxy-6-[(2-hydroxy-2-methylpropanoyl)oxy]oxane-2-carboxylic acid |
|---|
| Frequency | 30.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H16O9 |
|---|
| Molecular Mass | 280.0794 |
|---|
| SMILES | CC(C)(O)C(=O)OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | FBNCKTFFNYNGNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcoholstertiary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaliphatic heteromonocyclic compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacycletertiary alcoholpyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivative |
|---|