| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:53 UTC |
|---|
| Update Date | 2025-03-21 18:32:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00092948 |
|---|
| Frequency | 30.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13NO5 |
|---|
| Molecular Mass | 263.0794 |
|---|
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCC(O)C(=O)O |
|---|
| InChI Key | IQLVJWFUFXOQFQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolessecondary alcoholssugar acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidindolealpha-hydroxy acidmonosaccharidecarboxylic acid derivativesaccharideorganic oxideglyceric_acidaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholazacycleheteroaromatic compoundhydroxy acidorganic oxygen compoundcarboxylic acid esterpyrrolesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
