| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:57 UTC |
|---|
| Update Date | 2025-03-21 18:32:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093086 |
|---|
| Frequency | 30.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H14O10 |
|---|
| Molecular Mass | 390.0587 |
|---|
| SMILES | O=C(O)C1OOC(Oc2ccc3c(c2)oc(=O)c2cc(O)ccc23)C(O)C1O |
|---|
| InChI Key | IJHNTIJBFHLKGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,2-dioxanes1-benzopyrans1-hydroxy-2-unsubstituted benzenoids2-benzopyransbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl peroxidesheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenol etherspyranones and derivativessecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acid1-benzopyran1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactonebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compounddialkyl peroxidepyranoneorganoheterocyclic compound1,2-diolalcoholbenzopyranheteroaromatic compoundhydroxy acidisocoumarincoumarinoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyran2-benzopyransecondary alcoholhydrocarbon derivativebenzenoidortho-dioxaneorganooxygen compound |
|---|