| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-21 00:12:57 UTC |
|---|
| Update Date | 2025-03-21 18:32:52 UTC |
|---|
| HMDB ID | HMDB0094647 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093090 |
|---|
| Name | Mono-(2-ethyl-5-carboxypentyl) phthalate |
|---|
| Frequency | 30.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20O6 |
|---|
| Molecular Mass | 308.126 |
|---|
| SMILES | CCC(CCCC(=O)O)COC(=O)c1ccccc1C(=O)O |
|---|
| InChI Key | XFGRNAPKLGXDGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesorganic oxidestricarboxylic acids and derivatives |
|---|
| Substituents | carbonyl groupcarboxylic acidbenzoyltricarboxylic acid or derivativesbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterhydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compound |
|---|
