| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:12:59 UTC |
|---|
| Update Date | 2025-03-21 18:32:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093190 |
|---|
| Frequency | 30.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O3 |
|---|
| Molecular Mass | 254.0943 |
|---|
| SMILES | O=C(Cc1ccccc1)OC(=O)Cc1ccccc1 |
|---|
| InChI Key | JAUFWTSSYRTLLB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid anhydridesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietycarbonyl grouporganic oxideorganic oxygen compoundcarboxylic acid anhydridedicarboxylic acid or derivativeshydrocarbon derivativecarboxylic acid derivativeorganooxygen compound |
|---|
