| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:01 UTC |
|---|
| Update Date | 2025-03-21 18:32:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093263 |
|---|
| Frequency | 29.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O6 |
|---|
| Molecular Mass | 302.079 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)C(=O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | PWRDKNDTBDSOAE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | acylphloroglucinols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha-diketonesaryl ketonesbenzoyl derivativesbutyrophenoneshydrocarbon derivativesorganic oxidesvinylogous acids |
|---|
| Substituents | acylphloroglucinol derivativemonocyclic benzene moietycarbonyl groupbenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalpha-diketoneketonebutyrophenonearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
