| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:04 UTC |
|---|
| Update Date | 2025-03-21 18:32:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093371 |
|---|
| Frequency | 29.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9ClN5O5P |
|---|
| Molecular Mass | 333.003 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC(Cl)C2OP(=O)(O)OC21 |
|---|
| InChI Key | AZEIHHIHYKKOKY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | ribonucleoside 3'-phosphates |
|---|
| Subclass | ribonucleoside 3'-phosphates |
|---|
| Direct Parent | ribonucleoside 3'-phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl chloridesazacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganochloridesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsprimary aminespurines and purine derivativespyrimidines and pyrimidine derivativestetrahydrofurans |
|---|
| Substituents | alkyl chlorideorganochlorideimidazopyrimidineorganohalogen compoundpyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideimidolactamorganoheterocyclic compoundazolen-substituted imidazoleribonucleoside 3'-phosphateazacycletetrahydrofuranheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|