| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:05 UTC |
|---|
| Update Date | 2025-03-21 18:32:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093428 |
|---|
| Frequency | 29.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11N5O4 |
|---|
| Molecular Mass | 229.0811 |
|---|
| SMILES | CN(CC(=O)O)C(=N)NC1NC(=O)NC1=O |
|---|
| InChI Key | CCEDQNWUGNDJOC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azolidines |
|---|
| Subclass | imidazolidines |
|---|
| Direct Parent | hydantoins |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboximidamidescarboxylic acidsdicarboximidesguanidineshydrocarbon derivativesimidazolidinonesiminesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | carbonyl groupcarboxylic acidguanidineiminealpha-amino acid or derivativescarboxylic acid derivativeorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidecarbonic acid derivativeazacyclecarboximidamidemonocarboxylic acid or derivativesorganic oxygen compoundhydantoinhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
