| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:06 UTC |
|---|
| Update Date | 2025-03-21 18:32:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093487 |
|---|
| Frequency | 29.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H25Cl2N3O8 |
|---|
| Molecular Mass | 577.1019 |
|---|
| SMILES | O=C(O)CCC(NC(=O)c1ccc(OCC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)cc1)C(=O)O |
|---|
| InChI Key | OWAQBOOMFJEJHT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesalkyl aryl ethersalpha amino acidsaryl chloridesazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesdichlorobenzenesheteroaromatic compoundshippuric acids and derivativeshydrocarbon derivativesimidazolesketalsn-acyl-alpha amino acidsn-substituted imidazolesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietymeta-dioxolanecarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundorganochloridebenzoylalkyl aryl etherorganohalogen compoundbenzamide1,3-dichlorobenzeneorganic oxideacetalimidazoleketalorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolen-acyl-alpha amino acid or derivativesaryl chloridechlorobenzeneazacyclen-acyl-alpha-amino acidhippuric acid or derivativesheteroaromatic compoundbenzoic acid or derivativesglutamic acid or derivativescarboxamide grouparyl halideoxacyclesecondary carboxylic acid amideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compoundorganooxygen compound |
|---|
