| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 00:13:08 UTC |
|---|
| Update Date | 2025-03-21 18:32:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00093541 |
|---|
| Frequency | 29.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20O6 |
|---|
| Molecular Mass | 356.126 |
|---|
| SMILES | OCC1OC(Oc2cccc3c2ccc2ccccc23)C(O)C(O)C1O |
|---|
| InChI Key | RYTFSXYZAYHCOC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetalshydrocarbon derivativesmonosaccharidesnaphthalenesoxacyclic compoundsoxanesphenol ethersprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholphenol etherphenanthrenemonosaccharideoxacyclesaccharidenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundsecondary alcoholhydrocarbon derivativeoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|